C28H30N6O5 — CID 91216890
5-[5-azido-5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-3-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-1,3-oxazolidin-2-one (PubChem CID 91216890) has the molecular formula C28H30N6O5 and a molecular weight of 530.59 g/mol. Its IUPAC name is 5-[5-azido-5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-3-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[5-azido-5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-3-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91216890 |
| Molecular Formula | C28H30N6O5 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | 5-[5-azido-5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-3-[6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxin-2-yl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc2nccc(C(CCCCC3CN(C4=COC=C(CC5=CC=CCC5)O4)C(=O)O3)N=[N+]=[N-])c2n1 |
| InChI | InChI=1S/C28H30N6O5/c1-36-25-12-11-24-27(31-25)22(13-14-30-24)23(32-33-29)10-6-5-9-20-16-34(28(35)39-20)26-18-37-17-21(38-26)15-19-7-3-2-4-8-19/h2-3,7,11-14,17-18,20,23H,4-6,8-10,15-16H2,1H3 |
| InChIKey | BNKVOXNVNZGHIS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 131.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|