C21H36 — CID 91217519
2-(1-cyclohexylethyl)-2-methyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylene (PubChem CID 91217519) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 2-(1-cyclohexylethyl)-2-methyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylene.
| Compound Name | 2-(1-cyclohexylethyl)-2-methyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylene |
|---|---|
| PubChem CID | 91217519 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 2-(1-cyclohexylethyl)-2-methyl-3,3a,4,5,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylene |
| SMILES | CC(C1CCCCC1)C1(C)CC2CCCC3CCCC1C32 |
| InChI | InChI=1S/C21H36/c1-15(16-8-4-3-5-9-16)21(2)14-18-12-6-10-17-11-7-13-19(21)20(17)18/h15-20H,3-14H2,1-2H3 |
| InChIKey | RVWZAPSTRXHUJO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |