C44H78O8 — CID 91217736
[10-(4-butan-2-yl-3,6-dimethyloxan-2-yl)oxy-2-ethyl-5-formyl-3,5,7,9,11,13-hexamethyl-4-(3-methyloctan-2-yl)-12,14-dioxo-oxacyclotetradec-3-yl] acetate (PubChem CID 91217736) has the molecular formula C44H78O8 and a molecular weight of 735.10 g/mol. Its IUPAC name is [10-(4-butan-2-yl-3,6-dimethyloxan-2-yl)oxy-2-ethyl-5-formyl-3,5,7,9,11,13-hexamethyl-4-(3-methyloctan-2-yl)-12,14-dioxo-oxacyclotetradec-3-yl] acetate.
| Compound Name | [10-(4-butan-2-yl-3,6-dimethyloxan-2-yl)oxy-2-ethyl-5-formyl-3,5,7,9,11,13-hexamethyl-4-(3-methyloctan-2-yl)-12,14-dioxo-oxacyclotetradec-3-yl] acetate |
|---|---|
| PubChem CID | 91217736 |
| Molecular Formula | C44H78O8 |
| Molecular Weight | 735.10 g/mol |
| Exact Mass | 734.57 |
| IUPAC Name | [10-(4-butan-2-yl-3,6-dimethyloxan-2-yl)oxy-2-ethyl-5-formyl-3,5,7,9,11,13-hexamethyl-4-(3-methyloctan-2-yl)-12,14-dioxo-oxacyclotetradec-3-yl] acetate |
| SMILES | CCCCCC(C)C(C)C1C(C)(C=O)CC(C)CC(C)C(OC2OC(C)CC(C(C)CC)C2C)C(C)C(=O)C(C)C(=O)OC(CC)C1(C)OC(C)=O |
| InChI | InChI=1S/C44H78O8/c1-16-19-20-21-28(6)31(9)40-43(14,25-45)24-26(4)22-29(7)39(51-42-32(10)36(27(5)17-2)23-30(8)49-42)33(11)38(47)34(12)41(48)50-37(18-3)44(40,15)52-35(13)46/h25-34,36-37,39-40,42H,16-24H2,1-15H3 |
| InChIKey | XCMWAUGEJVZSQG-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.10 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|