About 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate
2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate (PubChem CID 91218425) has the molecular formula C15H15NO5
and a molecular weight of 289.29 g/mol. Its IUPAC name is 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate.
Molecular Properties
| Compound Name | 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate |
| PubChem CID | 91218425 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)OC1=CC=CCO1 |
| InChI | InChI=1S/C15H15NO5/c17-13(21-14-8-4-5-9-19-14)10-16-15(18)20-11-12-6-2-1-3-7-12/h1-8H,9-11H2,(H,16,18) |
| InChIKey | LJFNGVMQAVCCOD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate?
The IUPAC name of 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate (CID 91218425) is 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate.
What is the SMILES notation for 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate?
The canonical SMILES for 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate is O=C(CNC(=O)OCc1ccccc1)OC1=CC=CCO1.
What is the InChIKey of 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate?
The InChIKey is LJFNGVMQAVCCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5/c17-13(21-14-8-4-5-9-19-14)10-16-15(18)20-11-12-6-2-1-3-7-12/h1-8H,9-11H2,(H,16,18).
What are the key properties of 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate?
2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate has a molecular weight of 289.29 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyran-6-yl 2-(phenylmethoxycarbonylamino)acetate is sourced from PubChem (CID 91218425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).