C18H20ClFN4O3 — CID 91218538
2-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]ethyl N-(5-fluoro-4-methyl-2-pyridinyl)carbamate (PubChem CID 91218538) has the molecular formula C18H20ClFN4O3 and a molecular weight of 394.83 g/mol. Its IUPAC name is 2-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]ethyl N-(5-fluoro-4-methyl-2-pyridinyl)carbamate.
| Compound Name | 2-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]ethyl N-(5-fluoro-4-methyl-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 91218538 |
| Molecular Formula | C18H20ClFN4O3 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[[2-[(2-chlorophenyl)methylamino]acetyl]amino]ethyl N-(5-fluoro-4-methyl-2-pyridinyl)carbamate |
| SMILES | Cc1cc(NC(=O)OCCNC(=O)CNCc2ccccc2Cl)ncc1F |
| InChI | InChI=1S/C18H20ClFN4O3/c1-12-8-16(23-10-15(12)20)24-18(26)27-7-6-22-17(25)11-21-9-13-4-2-3-5-14(13)19/h2-5,8,10,21H,6-7,9,11H2,1H3,(H,22,25)(H,23,24,26) |
| InChIKey | ZSYPYZNLMJDYHG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|