C17H18ClFN4O3 — CID 87654077
2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(5-fluoro-2-pyridinyl)carbamate (PubChem CID 87654077) has the molecular formula C17H18ClFN4O3 and a molecular weight of 380.81 g/mol. Its IUPAC name is 2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(5-fluoro-2-pyridinyl)carbamate.
| Compound Name | 2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(5-fluoro-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 87654077 |
| Molecular Formula | C17H18ClFN4O3 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[acetyl-[(2-chlorophenyl)methylamino]amino]ethyl N-(5-fluoro-2-pyridinyl)carbamate |
| SMILES | CC(=O)N(CCOC(=O)Nc1ccc(F)cn1)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClFN4O3/c1-12(24)23(21-10-13-4-2-3-5-15(13)18)8-9-26-17(25)22-16-7-6-14(19)11-20-16/h2-7,11,21H,8-10H2,1H3,(H,20,22,25) |
| InChIKey | KNHJWUUKCLPICY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|