C22H22ClFN4O4 — CID 91002535
2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]ethyl N-[6-(hydroxymethyl)isoquinolin-3-yl]carbamate (PubChem CID 91002535) has the molecular formula C22H22ClFN4O4 and a molecular weight of 460.89 g/mol. Its IUPAC name is 2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]ethyl N-[6-(hydroxymethyl)isoquinolin-3-yl]carbamate.
| Compound Name | 2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]ethyl N-[6-(hydroxymethyl)isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 91002535 |
| Molecular Formula | C22H22ClFN4O4 |
| Molecular Weight | 460.89 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-[[2-[(2-chloro-3-fluorophenyl)methylamino]acetyl]amino]ethyl N-[6-(hydroxymethyl)isoquinolin-3-yl]carbamate |
| SMILES | O=C(CNCc1cccc(F)c1Cl)NCCOC(=O)Nc1cc2cc(CO)ccc2cn1 |
| InChI | InChI=1S/C22H22ClFN4O4/c23-21-16(2-1-3-18(21)24)10-25-12-20(30)26-6-7-32-22(31)28-19-9-17-8-14(13-29)4-5-15(17)11-27-19/h1-5,8-9,11,25,29H,6-7,10,12-13H2,(H,26,30)(H,27,28,31) |
| InChIKey | DMXBNHIFKVRFIX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.89 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|