C23H23ClF2N4O3 — CID 90694553
2-[3-[(2-chloro-3-fluorophenyl)methylamino]butanoylamino]ethyl N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 90694553) has the molecular formula C23H23ClF2N4O3 and a molecular weight of 476.91 g/mol. Its IUPAC name is 2-[3-[(2-chloro-3-fluorophenyl)methylamino]butanoylamino]ethyl N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | 2-[3-[(2-chloro-3-fluorophenyl)methylamino]butanoylamino]ethyl N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 90694553 |
| Molecular Formula | C23H23ClF2N4O3 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[3-[(2-chloro-3-fluorophenyl)methylamino]butanoylamino]ethyl N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | CC(CC(=O)NCCOC(=O)Nc1cc2cc(F)ccc2cn1)NCc1cccc(F)c1Cl |
| InChI | InChI=1S/C23H23ClF2N4O3/c1-14(28-13-16-3-2-4-19(26)22(16)24)9-21(31)27-7-8-33-23(32)30-20-11-17-10-18(25)6-5-15(17)12-29-20/h2-6,10-12,14,28H,7-9,13H2,1H3,(H,27,31)(H,29,30,32) |
| InChIKey | OIUYCHBENNDQAB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|