About 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate
1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate (PubChem CID 91223415) has the molecular formula C21H35O3S-
and a molecular weight of 367.58 g/mol. Its IUPAC name is 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate.
Molecular Properties
| Compound Name | 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate |
| PubChem CID | 91223415 |
| Molecular Formula | C21H35O3S- |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate |
| SMILES | CC(C)S(=O)[O-].CCCCCCc1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H28O.C3H8O2S/c1-2-3-4-6-9-16-12-14-18(15-13-16)19-17-10-7-5-8-11-17;1-3(2)6(4)5/h12-15,17H,2-11H2,1H3;3H,1-2H3,(H,4,5)/p-1 |
| InChIKey | DPGKTUHMNOITCJ-UHFFFAOYSA-M |
| XLogP | 5.79 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate?
The IUPAC name of 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate (CID 91223415) is 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate.
What is the SMILES notation for 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate?
The canonical SMILES for 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate is CC(C)S(=O)[O-].CCCCCCc1ccc(OC2CCCCC2)cc1.
What is the InChIKey of 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate?
The InChIKey is DPGKTUHMNOITCJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H28O.C3H8O2S/c1-2-3-4-6-9-16-12-14-18(15-13-16)19-17-10-7-5-8-11-17;1-3(2)6(4)5/h12-15,17H,2-11H2,1H3;3H,1-2H3,(H,4,5)/p-1.
What are the key properties of 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate?
1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate has a molecular weight of 367.58 g/mol, XLogP of 5.79, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyloxy-4-hexylbenzene;propane-2-sulfinate is sourced from PubChem (CID 91223415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).