C24H22F3NO5S — CID 91225489
benzyl (2S)-2-(benzylamino)-3-[4-hydroxy-2-(trifluoromethylsulfonyl)phenyl]propanoate (PubChem CID 91225489) has the molecular formula C24H22F3NO5S and a molecular weight of 493.50 g/mol. Its IUPAC name is benzyl (2S)-2-(benzylamino)-3-[4-hydroxy-2-(trifluoromethylsulfonyl)phenyl]propanoate.
| Compound Name | benzyl (2S)-2-(benzylamino)-3-[4-hydroxy-2-(trifluoromethylsulfonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 91225489 |
| Molecular Formula | C24H22F3NO5S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | benzyl (2S)-2-(benzylamino)-3-[4-hydroxy-2-(trifluoromethylsulfonyl)phenyl]propanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](Cc1ccc(O)cc1S(=O)(=O)C(F)(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C24H22F3NO5S/c25-24(26,27)34(31,32)22-14-20(29)12-11-19(22)13-21(28-15-17-7-3-1-4-8-17)23(30)33-16-18-9-5-2-6-10-18/h1-12,14,21,28-29H,13,15-16H2/t21-/m0/s1 |
| InChIKey | JWFCGKCMRYGXCD-NRFANRHFSA-N |
| XLogP | 4.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |