C24H27N3O3S — CID 91227401
2-[2-[4-(hydroxymethyl)phenyl]ethynylamino]propan-2-yl 2-[(5-ethyl-6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetate (PubChem CID 91227401) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-[2-[4-(hydroxymethyl)phenyl]ethynylamino]propan-2-yl 2-[(5-ethyl-6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetate.
| Compound Name | 2-[2-[4-(hydroxymethyl)phenyl]ethynylamino]propan-2-yl 2-[(5-ethyl-6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 91227401 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[2-[4-(hydroxymethyl)phenyl]ethynylamino]propan-2-yl 2-[(5-ethyl-6-methyl-1H-benzimidazol-2-yl)sulfanyl]acetate |
| SMILES | CCc1cc2nc(SCC(=O)OC(C)(C)NC#Cc3ccc(CO)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C24H27N3O3S/c1-5-19-13-21-20(12-16(19)2)26-23(27-21)31-15-22(29)30-24(3,4)25-11-10-17-6-8-18(14-28)9-7-17/h6-9,12-13,25,28H,5,14-15H2,1-4H3,(H,26,27) |
| InChIKey | KKRJRPAIHGXNSU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|