C29H34O4 — CID 91228789
(5R,6R,9R)-9-(4-methoxyphenyl)-6-methyl-3'-methylidenespiro[8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-diene-5,2'-oxolane]-14-one (PubChem CID 91228789) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (5R,6R,9R)-9-(4-methoxyphenyl)-6-methyl-3'-methylidenespiro[8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-diene-5,2'-oxolane]-14-one.
| Compound Name | (5R,6R,9R)-9-(4-methoxyphenyl)-6-methyl-3'-methylidenespiro[8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-diene-5,2'-oxolane]-14-one |
|---|---|
| PubChem CID | 91228789 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (5R,6R,9R)-9-(4-methoxyphenyl)-6-methyl-3'-methylidenespiro[8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-diene-5,2'-oxolane]-14-one |
| SMILES | C=C1CCO[C@]12CCC1C3CC=C4CC(=O)CCC4=C3[C@@H](c3ccc(OC)cc3)OC[C@@]12C |
| InChI | InChI=1S/C29H34O4/c1-18-13-15-33-29(18)14-12-25-24-10-6-20-16-21(30)7-11-23(20)26(24)27(32-17-28(25,29)2)19-4-8-22(31-3)9-5-19/h4-6,8-9,24-25,27H,1,7,10-17H2,2-3H3/t24?,25?,27-,28+,29-/m1/s1 |
| InChIKey | TXCQBZNAKBXTID-OGPUHFDBSA-N |
| XLogP | 5.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|