C28H34O4 — CID 143531197
(1S,4S)-4-(hydroxymethyl)-1-(4-methoxyphenyl)-4-methyl-5-pent-4-ynyl-1,3,5,5a,6,7,10,11-octahydrobenzo[i][2]benzoxepin-9-one (PubChem CID 143531197) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is (1S,4S)-4-(hydroxymethyl)-1-(4-methoxyphenyl)-4-methyl-5-pent-4-ynyl-1,3,5,5a,6,7,10,11-octahydrobenzo[i][2]benzoxepin-9-one.
| Compound Name | (1S,4S)-4-(hydroxymethyl)-1-(4-methoxyphenyl)-4-methyl-5-pent-4-ynyl-1,3,5,5a,6,7,10,11-octahydrobenzo[i][2]benzoxepin-9-one |
|---|---|
| PubChem CID | 143531197 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (1S,4S)-4-(hydroxymethyl)-1-(4-methoxyphenyl)-4-methyl-5-pent-4-ynyl-1,3,5,5a,6,7,10,11-octahydrobenzo[i][2]benzoxepin-9-one |
| SMILES | C#CCCCC1C2CCC3=CC(=O)CCC3=C2[C@H](c2ccc(OC)cc2)OC[C@]1(C)CO |
| InChI | InChI=1S/C28H34O4/c1-4-5-6-7-25-24-14-10-20-16-21(30)11-15-23(20)26(24)27(32-18-28(25,2)17-29)19-8-12-22(31-3)13-9-19/h1,8-9,12-13,16,24-25,27,29H,5-7,10-11,14-15,17-18H2,2-3H3/t24?,25?,27-,28-/m0/s1 |
| InChIKey | PGBYSANUCJYXLP-ININXCKQSA-N |
| XLogP | 5.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|