C34H38O4 — CID 71172295
(14S,15S,18R)-14-hydroxy-18-(4-methoxyphenyl)-11,15-dimethyl-14-(2-phenylethynyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-dien-5-one (PubChem CID 71172295) has the molecular formula C34H38O4 and a molecular weight of 510.67 g/mol. Its IUPAC name is (14S,15S,18R)-14-hydroxy-18-(4-methoxyphenyl)-11,15-dimethyl-14-(2-phenylethynyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-dien-5-one.
| Compound Name | (14S,15S,18R)-14-hydroxy-18-(4-methoxyphenyl)-11,15-dimethyl-14-(2-phenylethynyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-dien-5-one |
|---|---|
| PubChem CID | 71172295 |
| Molecular Formula | C34H38O4 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | (14S,15S,18R)-14-hydroxy-18-(4-methoxyphenyl)-11,15-dimethyl-14-(2-phenylethynyl)-17-oxatricyclo[8.8.0.02,7]octadeca-1,6-dien-5-one |
| SMILES | COc1ccc([C@H]2OC[C@H](C)[C@](O)(C#Cc3ccccc3)CCC(C)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C34H38O4/c1-23-17-19-34(36,20-18-25-7-5-4-6-8-25)24(2)22-38-33(26-9-13-29(37-3)14-10-26)32-30(23)15-11-27-21-28(35)12-16-31(27)32/h4-10,13-14,21,23-24,30,33,36H,11-12,15-17,19,22H2,1-3H3/t23?,24-,30?,33+,34+/m0/s1 |
| InChIKey | BWSJDJQVYALLTB-VTUAVXAMSA-N |
| XLogP | 6.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|