C34H35F2NO3 — CID 91484403
(5R,6R,9R)-5-[2-(3,5-difluorophenyl)ethynyl]-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-dien-14-one (PubChem CID 91484403) has the molecular formula C34H35F2NO3 and a molecular weight of 543.65 g/mol. Its IUPAC name is (5R,6R,9R)-5-[2-(3,5-difluorophenyl)ethynyl]-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-dien-14-one.
| Compound Name | (5R,6R,9R)-5-[2-(3,5-difluorophenyl)ethynyl]-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-dien-14-one |
|---|---|
| PubChem CID | 91484403 |
| Molecular Formula | C34H35F2NO3 |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (5R,6R,9R)-5-[2-(3,5-difluorophenyl)ethynyl]-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,16-dien-14-one |
| SMILES | CN(C)c1ccc([C@H]2OC[C@@]3(C)C(CC[C@@]3(O)C#Cc3cc(F)cc(F)c3)C3CC=C4CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C34H35F2NO3/c1-33-20-40-32(22-4-7-26(8-5-22)37(2)3)31-28-11-9-27(38)18-23(28)6-10-29(31)30(33)13-15-34(33,39)14-12-21-16-24(35)19-25(36)17-21/h4-8,16-17,19,29-30,32,39H,9-11,13,15,18,20H2,1-3H3/t29?,30?,32-,33+,34+/m1/s1 |
| InChIKey | KLSNUVROOZKLQZ-YZPDVROPSA-N |
| XLogP | 6.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|