C31H35FN3O4+ — CID 91229016
tert-butyl N-[(1R,5S)-3-benzyl-3-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]carbamate (PubChem CID 91229016) has the molecular formula C31H35FN3O4+ and a molecular weight of 532.64 g/mol. Its IUPAC name is tert-butyl N-[(1R,5S)-3-benzyl-3-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,5S)-3-benzyl-3-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]carbamate |
|---|---|
| PubChem CID | 91229016 |
| Molecular Formula | C31H35FN3O4+ |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | tert-butyl N-[(1R,5S)-3-benzyl-3-[2-fluoro-4-(phenylmethoxycarbonylamino)phenyl]-3-azoniabicyclo[3.1.0]hexan-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1[C@H]2C[N+](Cc3ccccc3)(c3ccc(NC(=O)OCc4ccccc4)cc3F)C[C@@H]12 |
| InChI | InChI=1S/C31H34FN3O4/c1-31(2,3)39-30(37)34-28-24-18-35(19-25(24)28,17-21-10-6-4-7-11-21)27-15-14-23(16-26(27)32)33-29(36)38-20-22-12-8-5-9-13-22/h4-16,24-25,28H,17-20H2,1-3H3,(H-,33,34,36,37)/p+1/t24-,25+,28?,35? |
| InChIKey | JPOGYMVIWHGQSI-ZLKYXKMRSA-O |
| XLogP | 6.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|