C22H24BrN3 — CID 91229253
1-(7-bromo-1,4-dihydroisoquinolin-4-yl)-N-[4-(piperidin-1-ylmethyl)phenyl]methanimine (PubChem CID 91229253) has the molecular formula C22H24BrN3 and a molecular weight of 410.36 g/mol. Its IUPAC name is 1-(7-bromo-1,4-dihydroisoquinolin-4-yl)-N-[4-(piperidin-1-ylmethyl)phenyl]methanimine.
| Compound Name | 1-(7-bromo-1,4-dihydroisoquinolin-4-yl)-N-[4-(piperidin-1-ylmethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 91229253 |
| Molecular Formula | C22H24BrN3 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-(7-bromo-1,4-dihydroisoquinolin-4-yl)-N-[4-(piperidin-1-ylmethyl)phenyl]methanimine |
| SMILES | Brc1ccc2c(c1)CN=CC2/C=N/c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C22H24BrN3/c23-20-6-9-22-18(12-20)13-24-14-19(22)15-25-21-7-4-17(5-8-21)16-26-10-2-1-3-11-26/h4-9,12,14-15,19H,1-3,10-11,13,16H2/b25-15+ |
| InChIKey | HDHNPWCFIBEKSL-MFKUBSTISA-N |
| XLogP | 5.51 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|