C27H34O11 — CID 91230403
[(1S,2S,3R,4S,7R,9S,10S,15S)-4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] furan-3-carboxylate (PubChem CID 91230403) has the molecular formula C27H34O11 and a molecular weight of 534.56 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,15S)-4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] furan-3-carboxylate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,15S)-4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 91230403 |
| Molecular Formula | C27H34O11 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,15S)-4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] furan-3-carboxylate |
| SMILES | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)C(=O)C3C(C)[C@@H](O)C[C@@](O)([C@@H](OC(=O)c4ccoc4)[C@H]21)C3(C)C |
| InChI | InChI=1S/C27H34O11/c1-12-15(29)9-27(34)22(37-23(33)14-6-7-35-10-14)20-25(5,21(32)19(31)18(12)24(27,3)4)16(30)8-17-26(20,11-36-17)38-13(2)28/h6-7,10,12,15-18,20,22,29-30,34H,8-9,11H2,1-5H3/t12?,15-,16-,17+,18?,20-,22-,25+,26-,27+/m0/s1 |
| InChIKey | YEQQFFIJRDUMOA-ZXSOXQHPSA-N |
| XLogP | 0.82 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|