C30H38O11 — CID 91225441
[(1S,2S,4S,7R,9S,10S,15R)-1,9,15-trihydroxy-4-methoxycarbonyloxy-10,14,15,17,17-pentamethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] benzoate (PubChem CID 91225441) has the molecular formula C30H38O11 and a molecular weight of 574.62 g/mol. Its IUPAC name is [(1S,2S,4S,7R,9S,10S,15R)-1,9,15-trihydroxy-4-methoxycarbonyloxy-10,14,15,17,17-pentamethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] benzoate.
| Compound Name | [(1S,2S,4S,7R,9S,10S,15R)-1,9,15-trihydroxy-4-methoxycarbonyloxy-10,14,15,17,17-pentamethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] benzoate |
|---|---|
| PubChem CID | 91225441 |
| Molecular Formula | C30H38O11 |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | [(1S,2S,4S,7R,9S,10S,15R)-1,9,15-trihydroxy-4-methoxycarbonyloxy-10,14,15,17,17-pentamethyl-11,12-dioxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadecan-2-yl] benzoate |
| SMILES | COC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)C(=O)C3C(C)[C@](C)(O)C[C@@](O)(C(OC(=O)c4ccccc4)C12)C3(C)C |
| InChI | InChI=1S/C30H38O11/c1-15-19-20(32)22(33)28(5)17(31)12-18-29(14-39-18,41-25(35)38-6)21(28)23(40-24(34)16-10-8-7-9-11-16)30(37,26(19,2)3)13-27(15,4)36/h7-11,15,17-19,21,23,31,36-37H,12-14H2,1-6H3/t15?,17-,18+,19?,21?,23?,27+,28+,29-,30+/m0/s1 |
| InChIKey | PDVSELBTTLHGOO-BVRWMYKZSA-N |
| XLogP | 1.84 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|