C14H25NO2 — CID 91232421
methyl 5,6-dimethyl-2-(2-methylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 91232421) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is methyl 5,6-dimethyl-2-(2-methylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl 5,6-dimethyl-2-(2-methylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 91232421 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | methyl 5,6-dimethyl-2-(2-methylbutyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCC(C)CC1CC=C(C)C(C)N1C(=O)OC |
| InChI | InChI=1S/C14H25NO2/c1-6-10(2)9-13-8-7-11(3)12(4)15(13)14(16)17-5/h7,10,12-13H,6,8-9H2,1-5H3 |
| InChIKey | FDOJEWSKRFHMLD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|