C12H20N2O3 — CID 142754225
methyl 4-(1-ethoxyethenyl)-3-propan-2-yl-2H-imidazole-1-carboxylate (PubChem CID 142754225) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl 4-(1-ethoxyethenyl)-3-propan-2-yl-2H-imidazole-1-carboxylate.
| Compound Name | methyl 4-(1-ethoxyethenyl)-3-propan-2-yl-2H-imidazole-1-carboxylate |
|---|---|
| PubChem CID | 142754225 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl 4-(1-ethoxyethenyl)-3-propan-2-yl-2H-imidazole-1-carboxylate |
| SMILES | C=C(OCC)C1=CN(C(=O)OC)CN1C(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-6-17-10(4)11-7-13(12(15)16-5)8-14(11)9(2)3/h7,9H,4,6,8H2,1-3,5H3 |
| InChIKey | IJGYLUPULABSRH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|