C15H20N2O3S — CID 91233541
5-[3-[cyclohexyl(methyl)amino]-3-oxoprop-1-enyl]-N-hydroxythiophene-2-carboxamide (PubChem CID 91233541) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 5-[3-[cyclohexyl(methyl)amino]-3-oxoprop-1-enyl]-N-hydroxythiophene-2-carboxamide.
| Compound Name | 5-[3-[cyclohexyl(methyl)amino]-3-oxoprop-1-enyl]-N-hydroxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 91233541 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 5-[3-[cyclohexyl(methyl)amino]-3-oxoprop-1-enyl]-N-hydroxythiophene-2-carboxamide |
| SMILES | CN(C(=O)C=Cc1ccc(C(=O)NO)s1)C1CCCCC1 |
| InChI | InChI=1S/C15H20N2O3S/c1-17(11-5-3-2-4-6-11)14(18)10-8-12-7-9-13(21-12)15(19)16-20/h7-11,20H,2-6H2,1H3,(H,16,19) |
| InChIKey | JTKSWYDWDOLUPH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|