C19H38O4Si2 — CID 91233564
ethene;3-(2-trimethylsilyl-3-trimethylsilyloxypentyl)oxolane-2,5-dione (PubChem CID 91233564) has the molecular formula C19H38O4Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is ethene;3-(2-trimethylsilyl-3-trimethylsilyloxypentyl)oxolane-2,5-dione.
| Compound Name | ethene;3-(2-trimethylsilyl-3-trimethylsilyloxypentyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 91233564 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | ethene;3-(2-trimethylsilyl-3-trimethylsilyloxypentyl)oxolane-2,5-dione |
| SMILES | C=C.C=C.CCC(O[Si](C)(C)C)C(CC1CC(=O)OC1=O)[Si](C)(C)C |
| InChI | InChI=1S/C15H30O4Si2.2C2H4/c1-8-12(19-21(5,6)7)13(20(2,3)4)9-11-10-14(16)18-15(11)17;2*1-2/h11-13H,8-10H2,1-7H3;2*1-2H2 |
| InChIKey | OPFZBUWXKSDSLM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|