C33H64O12Si2 — CID 59918635
ethyl 8-[5-[dimethoxy(methyl)silyl]pentanoyloxy]-2-[2-[5-[dimethoxy(methyl)silyl]pentanoyloxy]propyl]-5-propanoyloxynonanoate (PubChem CID 59918635) has the molecular formula C33H64O12Si2 and a molecular weight of 709.03 g/mol. Its IUPAC name is ethyl 8-[5-[dimethoxy(methyl)silyl]pentanoyloxy]-2-[2-[5-[dimethoxy(methyl)silyl]pentanoyloxy]propyl]-5-propanoyloxynonanoate.
| Compound Name | ethyl 8-[5-[dimethoxy(methyl)silyl]pentanoyloxy]-2-[2-[5-[dimethoxy(methyl)silyl]pentanoyloxy]propyl]-5-propanoyloxynonanoate |
|---|---|
| PubChem CID | 59918635 |
| Molecular Formula | C33H64O12Si2 |
| Molecular Weight | 709.03 g/mol |
| Exact Mass | 708.39 |
| IUPAC Name | ethyl 8-[5-[dimethoxy(methyl)silyl]pentanoyloxy]-2-[2-[5-[dimethoxy(methyl)silyl]pentanoyloxy]propyl]-5-propanoyloxynonanoate |
| SMILES | CCOC(=O)C(CCC(CCC(C)OC(=O)CCCC[Si](C)(OC)OC)OC(=O)CC)CC(C)OC(=O)CCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C33H64O12Si2/c1-11-30(34)45-29(21-19-26(3)43-31(35)17-13-15-23-46(9,38-5)39-6)22-20-28(33(37)42-12-2)25-27(4)44-32(36)18-14-16-24-47(10,40-7)41-8/h26-29H,11-25H2,1-10H3 |
| InChIKey | NMVZCCRGXVZKKB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.03 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|