C22H48O4Si2 — CID 138980519
(3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanoic acid (PubChem CID 138980519) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is (3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanoic acid.
| Compound Name | (3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanoic acid |
|---|---|
| PubChem CID | 138980519 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (3S,5R)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylnonanoic acid |
| SMILES | C[C@H](CC(=O)O)C[C@@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O4Si2/c1-18(17-20(23)24)16-19(26-28(10,11)22(5,6)7)14-12-13-15-25-27(8,9)21(2,3)4/h18-19H,12-17H2,1-11H3,(H,23,24)/t18-,19+/m0/s1 |
| InChIKey | HCICENFHXYEECK-RBUKOAKNSA-N |
| XLogP | 7.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|