C33H35NO5 — CID 91234210
4-[2-(1H-indol-2-yl)-4-(4-octylphenoxy)-3-oxobutanoyl]benzoic acid (PubChem CID 91234210) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is 4-[2-(1H-indol-2-yl)-4-(4-octylphenoxy)-3-oxobutanoyl]benzoic acid.
| Compound Name | 4-[2-(1H-indol-2-yl)-4-(4-octylphenoxy)-3-oxobutanoyl]benzoic acid |
|---|---|
| PubChem CID | 91234210 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 4-[2-(1H-indol-2-yl)-4-(4-octylphenoxy)-3-oxobutanoyl]benzoic acid |
| SMILES | CCCCCCCCc1ccc(OCC(=O)C(C(=O)c2ccc(C(=O)O)cc2)c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C33H35NO5/c1-2-3-4-5-6-7-10-23-13-19-27(20-14-23)39-22-30(35)31(29-21-26-11-8-9-12-28(26)34-29)32(36)24-15-17-25(18-16-24)33(37)38/h8-9,11-21,31,34H,2-7,10,22H2,1H3,(H,37,38) |
| InChIKey | OBWLVRPVOLTQTE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|