C13H20N4O3 — CID 91238428
[(2R)-2-amino-2-pyridin-2-ylpropanoyl] (2R)-2,5-diaminopentanoate (PubChem CID 91238428) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is [(2R)-2-amino-2-pyridin-2-ylpropanoyl] (2R)-2,5-diaminopentanoate.
| Compound Name | [(2R)-2-amino-2-pyridin-2-ylpropanoyl] (2R)-2,5-diaminopentanoate |
|---|---|
| PubChem CID | 91238428 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(2R)-2-amino-2-pyridin-2-ylpropanoyl] (2R)-2,5-diaminopentanoate |
| SMILES | C[C@](N)(C(=O)OC(=O)[C@H](N)CCCN)c1ccccn1 |
| InChI | InChI=1S/C13H20N4O3/c1-13(16,10-6-2-3-8-17-10)12(19)20-11(18)9(15)5-4-7-14/h2-3,6,8-9H,4-5,7,14-16H2,1H3/t9-,13-/m1/s1 |
| InChIKey | JAHVFWAVOOVTOA-NOZJJQNGSA-N |
| XLogP | -0.61 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|