C15H25NO — CID 91238827
N-tert-butylundeca-2,7,9-trienamide (PubChem CID 91238827) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-tert-butylundeca-2,7,9-trienamide.
| Compound Name | N-tert-butylundeca-2,7,9-trienamide |
|---|---|
| PubChem CID | 91238827 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-tert-butylundeca-2,7,9-trienamide |
| SMILES | CC=CC=CCCCC=CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H25NO/c1-5-6-7-8-9-10-11-12-13-14(17)16-15(2,3)4/h5-8,12-13H,9-11H2,1-4H3,(H,16,17) |
| InChIKey | CWSOJLREQLPMIM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|