About 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene
1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene (PubChem CID 91239251) has the molecular formula C14H23FO2
and a molecular weight of 242.33 g/mol. Its IUPAC name is 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene |
| PubChem CID | 91239251 |
| Molecular Formula | C14H23FO2 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene |
| SMILES | CCC(C)(C)c1ccccc1.COC(C)OF |
| InChI | InChI=1S/C11H16.C3H7FO2/c1-4-11(2,3)10-8-6-5-7-9-10;1-3(5-2)6-4/h5-9H,4H2,1-3H3;3H,1-2H3 |
| InChIKey | AYHYSAGPXSKVIX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene?
The IUPAC name of 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene (CID 91239251) is 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene.
What is the SMILES notation for 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene?
The canonical SMILES for 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene is CCC(C)(C)c1ccccc1.COC(C)OF.
What is the InChIKey of 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene?
The InChIKey is AYHYSAGPXSKVIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C3H7FO2/c1-4-11(2,3)10-8-6-5-7-9-10;1-3(5-2)6-4/h5-9H,4H2,1-3H3;3H,1-2H3.
What are the key properties of 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene?
1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene has a molecular weight of 242.33 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethyl hypofluorite;2-methylbutan-2-ylbenzene is sourced from PubChem (CID 91239251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).