About 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene)
1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) (PubChem CID 91407102) has the molecular formula C29H48O4
and a molecular weight of 460.70 g/mol. Its IUPAC name is 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene).
Molecular Properties
| Compound Name | 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) |
| PubChem CID | 91407102 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) |
| SMILES | CCC(C)(C)c1ccccc1.CCC(C)(C)c1ccccc1.COC(C)OCOC(C)OC |
| InChI | InChI=1S/2C11H16.C7H16O4/c2*1-4-11(2,3)10-8-6-5-7-9-10;1-6(8-3)10-5-11-7(2)9-4/h2*5-9H,4H2,1-3H3;6-7H,5H2,1-4H3 |
| InChIKey | DJMCEVXXIPZXRE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene)?
The IUPAC name of 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) (CID 91407102) is 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene).
What is the SMILES notation for 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene)?
The canonical SMILES for 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) is CCC(C)(C)c1ccccc1.CCC(C)(C)c1ccccc1.COC(C)OCOC(C)OC.
What is the InChIKey of 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene)?
The InChIKey is DJMCEVXXIPZXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H16.C7H16O4/c2*1-4-11(2,3)10-8-6-5-7-9-10;1-6(8-3)10-5-11-7(2)9-4/h2*5-9H,4H2,1-3H3;6-7H,5H2,1-4H3.
What are the key properties of 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene)?
1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) has a molecular weight of 460.70 g/mol, XLogP of 7.71, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1-(1-methoxyethoxymethoxy)ethane;bis(2-methylbutan-2-ylbenzene) is sourced from PubChem (CID 91407102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).