C26H29N3O4S — CID 91239520
4-(1-benzylpiperidin-4-yl)oxy-6-[4-(1,3,2-dioxathian-5-yl)phenoxy]-5-methylpyrimidine (PubChem CID 91239520) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)oxy-6-[4-(1,3,2-dioxathian-5-yl)phenoxy]-5-methylpyrimidine.
| Compound Name | 4-(1-benzylpiperidin-4-yl)oxy-6-[4-(1,3,2-dioxathian-5-yl)phenoxy]-5-methylpyrimidine |
|---|---|
| PubChem CID | 91239520 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)oxy-6-[4-(1,3,2-dioxathian-5-yl)phenoxy]-5-methylpyrimidine |
| SMILES | Cc1c(Oc2ccc(C3COSOC3)cc2)ncnc1OC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O4S/c1-19-25(32-23-9-7-21(8-10-23)22-16-30-34-31-17-22)27-18-28-26(19)33-24-11-13-29(14-12-24)15-20-5-3-2-4-6-20/h2-10,18,22,24H,11-17H2,1H3 |
| InChIKey | RLZJOYBVPQNAOI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|