C23H25N5O4S — CID 136601990
4-(1,3,2-dioxathian-5-yl)-2-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]phenol (PubChem CID 136601990) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-(1,3,2-dioxathian-5-yl)-2-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]phenol.
| Compound Name | 4-(1,3,2-dioxathian-5-yl)-2-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 136601990 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-(1,3,2-dioxathian-5-yl)-2-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]phenol |
| SMILES | Cc1c(OC2CCN(c3ncccn3)CC2)ncnc1-c1cc(C2COSOC2)ccc1O |
| InChI | InChI=1S/C23H25N5O4S/c1-15-21(19-11-16(3-4-20(19)29)17-12-30-33-31-13-17)26-14-27-22(15)32-18-5-9-28(10-6-18)23-24-7-2-8-25-23/h2-4,7-8,11,14,17-18,29H,5-6,9-10,12-13H2,1H3 |
| InChIKey | HZTGNGBZCJFTFK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|