C20H22N6O2S — CID 87578263
N-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]oxy-1-thiophen-2-ylethanimine (PubChem CID 87578263) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]oxy-1-thiophen-2-ylethanimine.
| Compound Name | N-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]oxy-1-thiophen-2-ylethanimine |
|---|---|
| PubChem CID | 87578263 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[5-methyl-6-(1-pyrimidin-2-ylpiperidin-4-yl)oxypyrimidin-4-yl]oxy-1-thiophen-2-ylethanimine |
| SMILES | CC(=NOc1ncnc(OC2CCN(c3ncccn3)CC2)c1C)c1cccs1 |
| InChI | InChI=1S/C20H22N6O2S/c1-14-18(23-13-24-19(14)28-25-15(2)17-5-3-12-29-17)27-16-6-10-26(11-7-16)20-21-8-4-9-22-20/h3-5,8-9,12-13,16H,6-7,10-11H2,1-2H3 |
| InChIKey | ZYEHSFSSKREXPQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|