C20H21F3N4O5 — CID 87578648
4-[5-methyl-6-[(Z)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxypyrimidin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 87578648) has the molecular formula C20H21F3N4O5 and a molecular weight of 454.41 g/mol. Its IUPAC name is 4-[5-methyl-6-[(Z)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxypyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 4-[5-methyl-6-[(Z)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxypyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87578648 |
| Molecular Formula | C20H21F3N4O5 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 4-[5-methyl-6-[(Z)-1-[4-(trifluoromethoxy)phenyl]ethylideneamino]oxypyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | C/C(=N/Oc1ncnc(OC2CCN(C(=O)O)CC2)c1C)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N4O5/c1-12-17(30-15-7-9-27(10-8-15)19(28)29)24-11-25-18(12)32-26-13(2)14-3-5-16(6-4-14)31-20(21,22)23/h3-6,11,15H,7-10H2,1-2H3,(H,28,29)/b26-13- |
| InChIKey | AKYBEEORAYLVOF-ZMFRSBBQSA-N |
| XLogP | 4.01 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|