C25H29N5O4S — CID 91150126
4-[4-(1,3,2-dioxathian-5-yl)phenoxy]-6-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-5-methylpyrimidine (PubChem CID 91150126) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 4-[4-(1,3,2-dioxathian-5-yl)phenoxy]-6-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-5-methylpyrimidine.
| Compound Name | 4-[4-(1,3,2-dioxathian-5-yl)phenoxy]-6-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-5-methylpyrimidine |
|---|---|
| PubChem CID | 91150126 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 4-[4-(1,3,2-dioxathian-5-yl)phenoxy]-6-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-5-methylpyrimidine |
| SMILES | CCc1cnc(N2CCC(Oc3ncnc(Oc4ccc(C5COSOC5)cc4)c3C)CC2)nc1 |
| InChI | InChI=1S/C25H29N5O4S/c1-3-18-12-26-25(27-13-18)30-10-8-22(9-11-30)34-24-17(2)23(28-16-29-24)33-21-6-4-19(5-7-21)20-14-31-35-32-15-20/h4-7,12-13,16,20,22H,3,8-11,14-15H2,1-2H3 |
| InChIKey | SKIQDYMTHJXAAW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|