C20H18ClN7O4 — CID 91241908
5-N-(5-chloro-2-pyridinyl)-1-[4-(2-hydroxyimino-1,3-oxazolidin-3-yl)phenyl]-2H-pyrazine-5,6-dicarboxamide (PubChem CID 91241908) has the molecular formula C20H18ClN7O4 and a molecular weight of 455.86 g/mol. Its IUPAC name is 5-N-(5-chloro-2-pyridinyl)-1-[4-(2-hydroxyimino-1,3-oxazolidin-3-yl)phenyl]-2H-pyrazine-5,6-dicarboxamide.
| Compound Name | 5-N-(5-chloro-2-pyridinyl)-1-[4-(2-hydroxyimino-1,3-oxazolidin-3-yl)phenyl]-2H-pyrazine-5,6-dicarboxamide |
|---|---|
| PubChem CID | 91241908 |
| Molecular Formula | C20H18ClN7O4 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 5-N-(5-chloro-2-pyridinyl)-1-[4-(2-hydroxyimino-1,3-oxazolidin-3-yl)phenyl]-2H-pyrazine-5,6-dicarboxamide |
| SMILES | NC(=O)C1=C(C(=O)Nc2ccc(Cl)cn2)N=CCN1c1ccc(N2CCOC2=NO)cc1 |
| InChI | InChI=1S/C20H18ClN7O4/c21-12-1-6-15(24-11-12)25-19(30)16-17(18(22)29)27(8-7-23-16)13-2-4-14(5-3-13)28-9-10-32-20(28)26-31/h1-7,11,31H,8-10H2,(H2,22,29)(H,24,25,30) |
| InChIKey | LTJFRVIPZLREKN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|