C13H15N6O2+ — CID 91241973
[(N'-methylcarbamimidoyl)amino]-methylidene-[1-(2-nitrophenyl)pyrrol-2-yl]azanium (PubChem CID 91241973) has the molecular formula C13H15N6O2+ and a molecular weight of 287.30 g/mol. Its IUPAC name is [(N'-methylcarbamimidoyl)amino]-methylidene-[1-(2-nitrophenyl)pyrrol-2-yl]azanium.
| Compound Name | [(N'-methylcarbamimidoyl)amino]-methylidene-[1-(2-nitrophenyl)pyrrol-2-yl]azanium |
|---|---|
| PubChem CID | 91241973 |
| Molecular Formula | C13H15N6O2+ |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [(N'-methylcarbamimidoyl)amino]-methylidene-[1-(2-nitrophenyl)pyrrol-2-yl]azanium |
| SMILES | C=[N+](N/C(N)=N/C)c1cccn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N6O2/c1-15-13(14)16-17(2)12-8-5-9-18(12)10-6-3-4-7-11(10)19(20)21/h3-9H,2H2,1H3,(H3,14,15,16)/q+1 |
| InChIKey | AAGNFPVLBMUEQA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|