C15H16N6O4 — CID 166569838
carbamohydrazonoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium formate (PubChem CID 166569838) has the molecular formula C15H16N6O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is carbamohydrazonoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium formate.
| Compound Name | carbamohydrazonoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium formate |
|---|---|
| PubChem CID | 166569838 |
| Molecular Formula | C15H16N6O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | carbamohydrazonoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium formate |
| SMILES | NN=C(N)[NH+]=CC=Cc1cccn1-c1ccccc1[N+](=O)[O-].O=C[O-] |
| InChI | InChI=1S/C14H14N6O2.CH2O2/c15-14(18-16)17-9-3-5-11-6-4-10-19(11)12-7-1-2-8-13(12)20(21)22;2-1-3/h1-10H,16H2,(H2,15,18);1H,(H,2,3) |
| InChIKey | MLVDAJPQRDTPHN-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 166.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|