C32H34N12O8 — CID 171480537
bis(amino-carbamimidoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium);butanedioate (PubChem CID 171480537) has the molecular formula C32H34N12O8 and a molecular weight of 714.70 g/mol. Its IUPAC name is bis(amino-carbamimidoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium);butanedioate.
| Compound Name | bis(amino-carbamimidoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium);butanedioate |
|---|---|
| PubChem CID | 171480537 |
| Molecular Formula | C32H34N12O8 |
| Molecular Weight | 714.70 g/mol |
| Exact Mass | 714.26 |
| IUPAC Name | bis(amino-carbamimidoyl-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]azanium);butanedioate |
| SMILES | O=C([O-])CCC(=O)[O-].[H]/N=C(\N)[N+](N)=CC=Cc1cccn1-c1ccccc1[N+](=O)[O-].[H]/N=C(\N)[N+](N)=CC=Cc1cccn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/2C14H15N6O2.C4H6O4/c2*15-14(16)19(17)10-4-6-11-5-3-9-18(11)12-7-1-2-8-13(12)20(21)22;5-3(6)1-2-4(7)8/h2*1-10H,17H2,(H3,15,16);1-2H2,(H,5,6)(H,7,8)/q2*+1;/p-2 |
| InChIKey | DCLMVBJJHNFWOR-UHFFFAOYSA-L |
| XLogP | -0.24 |
| TPSA | 334.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.70 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|