C20H24N6O6 — CID 175818814
hexanedioic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine (PubChem CID 175818814) has the molecular formula C20H24N6O6 and a molecular weight of 444.45 g/mol. Its IUPAC name is hexanedioic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine.
| Compound Name | hexanedioic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine |
|---|---|
| PubChem CID | 175818814 |
| Molecular Formula | C20H24N6O6 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | hexanedioic acid;2-[3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylideneamino]guanidine |
| SMILES | NC(N)=NN=CC=Cc1cccn1-c1ccccc1[N+](=O)[O-].O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C14H14N6O2.C6H10O4/c15-14(16)18-17-9-3-5-11-6-4-10-19(11)12-7-1-2-8-13(12)20(21)22;7-5(8)3-1-2-4-6(9)10/h1-10H,(H4,15,16,18);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | CDEIHSMKWMQRGV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 199.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|