About 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine
1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine (PubChem CID 143409770) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine.
Molecular Properties
| Compound Name | 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine |
| PubChem CID | 143409770 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine |
| SMILES | C=C(C)n1cccc/c1=N\C.Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N2.C7H7NO2/c1-8(2)11-7-5-4-6-9(11)10-3;1-6-4-2-3-5-7(6)8(9)10/h4-7H,1H2,2-3H3;2-5H,1H3/b10-9+; |
| InChIKey | WPEUOZZOQPXLEF-RRABGKBLSA-N |
| XLogP | 3.41 |
| TPSA | 60.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine?
The IUPAC name of 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine (CID 143409770) is 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine.
What is the SMILES notation for 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine?
The canonical SMILES for 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine is C=C(C)n1cccc/c1=N\C.Cc1ccccc1[N+](=O)[O-].
What is the InChIKey of 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine?
The InChIKey is WPEUOZZOQPXLEF-RRABGKBLSA-N. The full InChI is InChI=1S/C9H12N2.C7H7NO2/c1-8(2)11-7-5-4-6-9(11)10-3;1-6-4-2-3-5-7(6)8(9)10/h4-7H,1H2,2-3H3;2-5H,1H3/b10-9+;.
What are the key properties of 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine?
1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine has a molecular weight of 285.35 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-nitrobenzene;N-methyl-1-prop-1-en-2-ylpyridin-2-imine is sourced from PubChem (CID 143409770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).