C20H19N5O4 — CID 51328061
6-methyl-1-(2-nitrophenyl)-3-(2-propan-2-yliminopyridine-1-carbonyl)pyridazin-4-one (PubChem CID 51328061) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 6-methyl-1-(2-nitrophenyl)-3-(2-propan-2-yliminopyridine-1-carbonyl)pyridazin-4-one.
| Compound Name | 6-methyl-1-(2-nitrophenyl)-3-(2-propan-2-yliminopyridine-1-carbonyl)pyridazin-4-one |
|---|---|
| PubChem CID | 51328061 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 6-methyl-1-(2-nitrophenyl)-3-(2-propan-2-yliminopyridine-1-carbonyl)pyridazin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)n2cccc/c2=N\C(C)C)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N5O4/c1-13(2)21-18-10-6-7-11-23(18)20(27)19-17(26)12-14(3)24(22-19)15-8-4-5-9-16(15)25(28)29/h4-13H,1-3H3/b21-18+ |
| InChIKey | FWZCEXMKRDNHDY-DYTRJAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|