C19H25BrN2O4 — CID 91243462
[(1R,3S,12R,16R)-9-bromo-8-methoxy-14-methoxyimino-16-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17)-trien-3-yl]methanol (PubChem CID 91243462) has the molecular formula C19H25BrN2O4 and a molecular weight of 425.32 g/mol. Its IUPAC name is [(1R,3S,12R,16R)-9-bromo-8-methoxy-14-methoxyimino-16-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17)-trien-3-yl]methanol.
| Compound Name | [(1R,3S,12R,16R)-9-bromo-8-methoxy-14-methoxyimino-16-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17)-trien-3-yl]methanol |
|---|---|
| PubChem CID | 91243462 |
| Molecular Formula | C19H25BrN2O4 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [(1R,3S,12R,16R)-9-bromo-8-methoxy-14-methoxyimino-16-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6,8,10(17)-trien-3-yl]methanol |
| SMILES | CON=C1C[C@@H](C)[C@]23C[C@@H](CO)NCc4cc(OC)c(Br)c(c42)O[C@@H]3C1 |
| InChI | InChI=1S/C19H25BrN2O4/c1-10-4-12(22-25-3)6-15-19(10)7-13(9-23)21-8-11-5-14(24-2)17(20)18(26-15)16(11)19/h5,10,13,15,21,23H,4,6-9H2,1-3H3/t10-,13+,15-,19+/m1/s1 |
| InChIKey | GLLOGWQUIMKTDD-SKUYYQHLSA-N |
| XLogP | 2.74 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|