C26H30ClN3O2S — CID 91245135
N-[2-(2-chlorophenyl)ethyl]-2-[(7-phenylheptanoylamino)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 91245135) has the molecular formula C26H30ClN3O2S and a molecular weight of 484.07 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-2-[(7-phenylheptanoylamino)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-2-[(7-phenylheptanoylamino)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91245135 |
| Molecular Formula | C26H30ClN3O2S |
| Molecular Weight | 484.07 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-2-[(7-phenylheptanoylamino)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CCCCCCc1ccccc1)NCc1nc(C(=O)NCCc2ccccc2Cl)cs1 |
| InChI | InChI=1S/C26H30ClN3O2S/c27-22-14-9-8-13-21(22)16-17-28-26(32)23-19-33-25(30-23)18-29-24(31)15-7-2-1-4-10-20-11-5-3-6-12-20/h3,5-6,8-9,11-14,19H,1-2,4,7,10,15-18H2,(H,28,32)(H,29,31) |
| InChIKey | FZBYIJFLWGRSFB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.07 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|