C26H30F4N7O+ — CID 91246225
N-[6-(1,5-dimethyl-1,2,4-triazol-1-ium-1-yl)-5-fluorohepta-2,4,6-trien-3-yl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 91246225) has the molecular formula C26H30F4N7O+ and a molecular weight of 532.57 g/mol. Its IUPAC name is N-[6-(1,5-dimethyl-1,2,4-triazol-1-ium-1-yl)-5-fluorohepta-2,4,6-trien-3-yl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[6-(1,5-dimethyl-1,2,4-triazol-1-ium-1-yl)-5-fluorohepta-2,4,6-trien-3-yl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 91246225 |
| Molecular Formula | C26H30F4N7O+ |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | N-[6-(1,5-dimethyl-1,2,4-triazol-1-ium-1-yl)-5-fluorohepta-2,4,6-trien-3-yl]-9-[4-(2,2,2-trifluoroethoxy)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | C=C(C(F)=CC(=CC)Nc1nc2n(n1)CCCCC2c1ccc(OCC(F)(F)F)cc1)[N+]1(C)N=CN=C1C |
| InChI | InChI=1S/C26H30F4N7O/c1-5-20(14-23(27)17(2)37(4)18(3)31-16-32-37)33-25-34-24-22(8-6-7-13-36(24)35-25)19-9-11-21(12-10-19)38-15-26(28,29)30/h5,9-12,14,16,22H,2,6-8,13,15H2,1,3-4H3,(H,33,35)/q+1 |
| InChIKey | ORGRTTYLGUMVOI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|