C19H22N4O4S — CID 91246973
5-cyano-N-[4-(methylsulfonylmethylamino)-2-piperidin-1-ylphenyl]furan-2-carboxamide (PubChem CID 91246973) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-cyano-N-[4-(methylsulfonylmethylamino)-2-piperidin-1-ylphenyl]furan-2-carboxamide.
| Compound Name | 5-cyano-N-[4-(methylsulfonylmethylamino)-2-piperidin-1-ylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91246973 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 5-cyano-N-[4-(methylsulfonylmethylamino)-2-piperidin-1-ylphenyl]furan-2-carboxamide |
| SMILES | CS(=O)(=O)CNc1ccc(NC(=O)c2ccc(C#N)o2)c(N2CCCCC2)c1 |
| InChI | InChI=1S/C19H22N4O4S/c1-28(25,26)13-21-14-5-7-16(17(11-14)23-9-3-2-4-10-23)22-19(24)18-8-6-15(12-20)27-18/h5-8,11,21H,2-4,9-10,13H2,1H3,(H,22,24) |
| InChIKey | UNNPTBLQYZOHAN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |