C27H38N6O3S2 — CID 91248839
2-[(4-cyclooctyl-5-ethyl-2,3,4a,9b-tetrahydro-1H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 91248839) has the molecular formula C27H38N6O3S2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 2-[(4-cyclooctyl-5-ethyl-2,3,4a,9b-tetrahydro-1H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(4-cyclooctyl-5-ethyl-2,3,4a,9b-tetrahydro-1H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 91248839 |
| Molecular Formula | C27H38N6O3S2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 2-[(4-cyclooctyl-5-ethyl-2,3,4a,9b-tetrahydro-1H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CCN1c2ccccc2C2NNC(SCC(=O)Nc3ccc(S(N)(=O)=O)cc3)N(C3CCCCCCC3)C21 |
| InChI | InChI=1S/C27H38N6O3S2/c1-2-32-23-13-9-8-12-22(23)25-26(32)33(20-10-6-4-3-5-7-11-20)27(31-30-25)37-18-24(34)29-19-14-16-21(17-15-19)38(28,35)36/h8-9,12-17,20,25-27,30-31H,2-7,10-11,18H2,1H3,(H,29,34)(H2,28,35,36) |
| InChIKey | FONMKLHLMQHHNI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |