C21H25BrN2O4S — CID 91250314
3-[bromo(phenyl)sulfamoyl]-N-cycloheptyl-4-methoxybenzamide (PubChem CID 91250314) has the molecular formula C21H25BrN2O4S and a molecular weight of 481.41 g/mol. Its IUPAC name is 3-[bromo(phenyl)sulfamoyl]-N-cycloheptyl-4-methoxybenzamide.
| Compound Name | 3-[bromo(phenyl)sulfamoyl]-N-cycloheptyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 91250314 |
| Molecular Formula | C21H25BrN2O4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-[bromo(phenyl)sulfamoyl]-N-cycloheptyl-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCCCCC2)cc1S(=O)(=O)N(Br)c1ccccc1 |
| InChI | InChI=1S/C21H25BrN2O4S/c1-28-19-14-13-16(21(25)23-17-9-5-2-3-6-10-17)15-20(19)29(26,27)24(22)18-11-7-4-8-12-18/h4,7-8,11-15,17H,2-3,5-6,9-10H2,1H3,(H,23,25) |
| InChIKey | NJDMSSZCOAMMDG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|