C21H24 — CID 91251395
2-(1-bicyclo[2.2.1]hept-2-enyl)-3-cyclopentylidene-1,2-dihydroindene (PubChem CID 91251395) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(1-bicyclo[2.2.1]hept-2-enyl)-3-cyclopentylidene-1,2-dihydroindene.
| Compound Name | 2-(1-bicyclo[2.2.1]hept-2-enyl)-3-cyclopentylidene-1,2-dihydroindene |
|---|---|
| PubChem CID | 91251395 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-(1-bicyclo[2.2.1]hept-2-enyl)-3-cyclopentylidene-1,2-dihydroindene |
| SMILES | C1=CC2(C3Cc4ccccc4C3=C3CCCC3)CCC1C2 |
| InChI | InChI=1S/C21H24/c1-2-6-16(5-1)20-18-8-4-3-7-17(18)13-19(20)21-11-9-15(14-21)10-12-21/h3-4,7-9,11,15,19H,1-2,5-6,10,12-14H2 |
| InChIKey | WZEQJLBHTQOWPJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|