C30H34F3NO3 — CID 91251405
[2-methyl-4-[[2-pentyl-3-[4-(trifluoromethyl)phenyl]anilino]methyl]phenyl] butaneperoxoate (PubChem CID 91251405) has the molecular formula C30H34F3NO3 and a molecular weight of 513.60 g/mol. Its IUPAC name is [2-methyl-4-[[2-pentyl-3-[4-(trifluoromethyl)phenyl]anilino]methyl]phenyl] butaneperoxoate.
| Compound Name | [2-methyl-4-[[2-pentyl-3-[4-(trifluoromethyl)phenyl]anilino]methyl]phenyl] butaneperoxoate |
|---|---|
| PubChem CID | 91251405 |
| Molecular Formula | C30H34F3NO3 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [2-methyl-4-[[2-pentyl-3-[4-(trifluoromethyl)phenyl]anilino]methyl]phenyl] butaneperoxoate |
| SMILES | CCCCCc1c(NCc2ccc(OOC(=O)CCC)c(C)c2)cccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H34F3NO3/c1-4-6-7-10-26-25(23-14-16-24(17-15-23)30(31,32)33)11-8-12-27(26)34-20-22-13-18-28(21(3)19-22)36-37-29(35)9-5-2/h8,11-19,34H,4-7,9-10,20H2,1-3H3 |
| InChIKey | XJCKKFXBPGFLBC-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|